C10H12F3N3O2 — CID 115521844
3-amino-2-(4,4,4-trifluorobutylamino)pyridine-4-carboxylic acid (PubChem CID 115521844) has the molecular formula C10H12F3N3O2 and a molecular weight of 263.22 g/mol. Its IUPAC name is 3-amino-2-(4,4,4-trifluorobutylamino)pyridine-4-carboxylic acid.
| Compound Name | 3-amino-2-(4,4,4-trifluorobutylamino)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 115521844 |
| Molecular Formula | C10H12F3N3O2 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 3-amino-2-(4,4,4-trifluorobutylamino)pyridine-4-carboxylic acid |
| SMILES | Nc1c(C(=O)O)ccnc1NCCCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O2/c11-10(12,13)3-1-4-15-8-7(14)6(9(17)18)2-5-16-8/h2,5H,1,3-4,14H2,(H,15,16)(H,17,18) |
| InChIKey | HQQYRUSFVGPZJG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|