C9H13N5O3 — CID 83114653
3-amino-2-[2-(carbamoylamino)ethylamino]pyridine-4-carboxylic acid (PubChem CID 83114653) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is 3-amino-2-[2-(carbamoylamino)ethylamino]pyridine-4-carboxylic acid.
| Compound Name | 3-amino-2-[2-(carbamoylamino)ethylamino]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 83114653 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-amino-2-[2-(carbamoylamino)ethylamino]pyridine-4-carboxylic acid |
| SMILES | NC(=O)NCCNc1nccc(C(=O)O)c1N |
| InChI | InChI=1S/C9H13N5O3/c10-6-5(8(15)16)1-2-12-7(6)13-3-4-14-9(11)17/h1-2H,3-4,10H2,(H,12,13)(H,15,16)(H3,11,14,17) |
| InChIKey | RHODZKRSIIGRGV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|