C14H18N4O3 — CID 106539333
2-[(6,7-dimethoxyisoquinolin-1-yl)amino]ethylurea (PubChem CID 106539333) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]ethylurea.
| Compound Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]ethylurea |
|---|---|
| PubChem CID | 106539333 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]ethylurea |
| SMILES | COc1cc2ccnc(NCCNC(N)=O)c2cc1OC |
| InChI | InChI=1S/C14H18N4O3/c1-20-11-7-9-3-4-16-13(10(9)8-12(11)21-2)17-5-6-18-14(15)19/h3-4,7-8H,5-6H2,1-2H3,(H,16,17)(H3,15,18,19) |
| InChIKey | WLQRMCXCUAQKKX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|