C15H19ClN2O2 — CID 106543113
N-(2-chlorobutyl)-6,7-dimethoxyisoquinolin-1-amine (PubChem CID 106543113) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is N-(2-chlorobutyl)-6,7-dimethoxyisoquinolin-1-amine.
| Compound Name | N-(2-chlorobutyl)-6,7-dimethoxyisoquinolin-1-amine |
|---|---|
| PubChem CID | 106543113 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-(2-chlorobutyl)-6,7-dimethoxyisoquinolin-1-amine |
| SMILES | CCC(Cl)CNc1nccc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C15H19ClN2O2/c1-4-11(16)9-18-15-12-8-14(20-3)13(19-2)7-10(12)5-6-17-15/h5-8,11H,4,9H2,1-3H3,(H,17,18) |
| InChIKey | AGJAOBAUKCNKDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|