C15H20N2O3 — CID 106539720
1-[(6,7-dimethoxyisoquinolin-1-yl)amino]butan-2-ol (PubChem CID 106539720) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-[(6,7-dimethoxyisoquinolin-1-yl)amino]butan-2-ol.
| Compound Name | 1-[(6,7-dimethoxyisoquinolin-1-yl)amino]butan-2-ol |
|---|---|
| PubChem CID | 106539720 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1-[(6,7-dimethoxyisoquinolin-1-yl)amino]butan-2-ol |
| SMILES | CCC(O)CNc1nccc2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C15H20N2O3/c1-4-11(18)9-17-15-12-8-14(20-3)13(19-2)7-10(12)5-6-16-15/h5-8,11,18H,4,9H2,1-3H3,(H,16,17) |
| InChIKey | SCMOHDVMXGXWRC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |