C14H17F2N3O2 — CID 106541100
N'-(6,7-dimethoxyisoquinolin-1-yl)-2,2-difluoropropane-1,3-diamine (PubChem CID 106541100) has the molecular formula C14H17F2N3O2 and a molecular weight of 297.31 g/mol. Its IUPAC name is N'-(6,7-dimethoxyisoquinolin-1-yl)-2,2-difluoropropane-1,3-diamine.
| Compound Name | N'-(6,7-dimethoxyisoquinolin-1-yl)-2,2-difluoropropane-1,3-diamine |
|---|---|
| PubChem CID | 106541100 |
| Molecular Formula | C14H17F2N3O2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N'-(6,7-dimethoxyisoquinolin-1-yl)-2,2-difluoropropane-1,3-diamine |
| SMILES | COc1cc2ccnc(NCC(F)(F)CN)c2cc1OC |
| InChI | InChI=1S/C14H17F2N3O2/c1-20-11-5-9-3-4-18-13(10(9)6-12(11)21-2)19-8-14(15,16)7-17/h3-6H,7-8,17H2,1-2H3,(H,18,19) |
| InChIKey | XYHLSADGNNSGMS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |