C14H19N3O2 — CID 106540624
1-N-(6,7-dimethoxyisoquinolin-1-yl)propane-1,2-diamine (PubChem CID 106540624) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-N-(6,7-dimethoxyisoquinolin-1-yl)propane-1,2-diamine.
| Compound Name | 1-N-(6,7-dimethoxyisoquinolin-1-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 106540624 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-N-(6,7-dimethoxyisoquinolin-1-yl)propane-1,2-diamine |
| SMILES | COc1cc2ccnc(NCC(C)N)c2cc1OC |
| InChI | InChI=1S/C14H19N3O2/c1-9(15)8-17-14-11-7-13(19-3)12(18-2)6-10(11)4-5-16-14/h4-7,9H,8,15H2,1-3H3,(H,16,17) |
| InChIKey | TYSRVELFSKPSCC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |