C16H22N2O3 — CID 106539049
2-[(6,7-dimethoxyisoquinolin-1-yl)amino]-3-methylbutan-1-ol (PubChem CID 106539049) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]-3-methylbutan-1-ol.
| Compound Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 106539049 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 2-[(6,7-dimethoxyisoquinolin-1-yl)amino]-3-methylbutan-1-ol |
| SMILES | COc1cc2ccnc(NC(CO)C(C)C)c2cc1OC |
| InChI | InChI=1S/C16H22N2O3/c1-10(2)13(9-19)18-16-12-8-15(21-4)14(20-3)7-11(12)5-6-17-16/h5-8,10,13,19H,9H2,1-4H3,(H,17,18) |
| InChIKey | VQSVTSROVHBRHF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 63.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |