C16H23N3O2 — CID 106543452
N-(6,7-dimethoxyisoquinolin-1-yl)-2-methylbutane-1,4-diamine (PubChem CID 106543452) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(6,7-dimethoxyisoquinolin-1-yl)-2-methylbutane-1,4-diamine.
| Compound Name | N-(6,7-dimethoxyisoquinolin-1-yl)-2-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 106543452 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(6,7-dimethoxyisoquinolin-1-yl)-2-methylbutane-1,4-diamine |
| SMILES | COc1cc2ccnc(NCC(C)CCN)c2cc1OC |
| InChI | InChI=1S/C16H23N3O2/c1-11(4-6-17)10-19-16-13-9-15(21-3)14(20-2)8-12(13)5-7-18-16/h5,7-9,11H,4,6,10,17H2,1-3H3,(H,18,19) |
| InChIKey | YLIBUIWTYJMGHV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |