C17H22N2O4 — CID 141101320
tert-butyl N-[(6,7-dimethoxyisoquinolin-1-yl)methyl]carbamate (PubChem CID 141101320) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is tert-butyl N-[(6,7-dimethoxyisoquinolin-1-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(6,7-dimethoxyisoquinolin-1-yl)methyl]carbamate |
|---|---|
| PubChem CID | 141101320 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl N-[(6,7-dimethoxyisoquinolin-1-yl)methyl]carbamate |
| SMILES | COc1cc2ccnc(CNC(=O)OC(C)(C)C)c2cc1OC |
| InChI | InChI=1S/C17H22N2O4/c1-17(2,3)23-16(20)19-10-13-12-9-15(22-5)14(21-4)8-11(12)6-7-18-13/h6-9H,10H2,1-5H3,(H,19,20) |
| InChIKey | UIEGCLDFYOZVQB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |