C21H29N3O6 — CID 87515439
tert-butyl N-[[4-[ethyl(methoxy)carbamoyl]-6,7-dimethoxyisoquinolin-1-yl]methyl]carbamate (PubChem CID 87515439) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is tert-butyl N-[[4-[ethyl(methoxy)carbamoyl]-6,7-dimethoxyisoquinolin-1-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[ethyl(methoxy)carbamoyl]-6,7-dimethoxyisoquinolin-1-yl]methyl]carbamate |
|---|---|
| PubChem CID | 87515439 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | tert-butyl N-[[4-[ethyl(methoxy)carbamoyl]-6,7-dimethoxyisoquinolin-1-yl]methyl]carbamate |
| SMILES | CCN(OC)C(=O)c1cnc(CNC(=O)OC(C)(C)C)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C21H29N3O6/c1-8-24(29-7)19(25)15-11-22-16(12-23-20(26)30-21(2,3)4)14-10-18(28-6)17(27-5)9-13(14)15/h9-11H,8,12H2,1-7H3,(H,23,26) |
| InChIKey | WOXKTFUSDLNMDN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|