C27H45N3O9 — CID 102224062
tert-butyl N-[[2,4,6-trimethoxy-3,5-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methyl]carbamate (PubChem CID 102224062) has the molecular formula C27H45N3O9 and a molecular weight of 555.67 g/mol. Its IUPAC name is tert-butyl N-[[2,4,6-trimethoxy-3,5-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2,4,6-trimethoxy-3,5-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 102224062 |
| Molecular Formula | C27H45N3O9 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | tert-butyl N-[[2,4,6-trimethoxy-3,5-bis[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methyl]carbamate |
| SMILES | COc1c(CNC(=O)OC(C)(C)C)c(OC)c(CNC(=O)OC(C)(C)C)c(OC)c1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H45N3O9/c1-25(2,3)37-22(31)28-13-16-19(34-10)17(14-29-23(32)38-26(4,5)6)21(36-12)18(20(16)35-11)15-30-24(33)39-27(7,8)9/h13-15H2,1-12H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | LVXQPKBUNKFERR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|