C9H19N2O5- — CID 131738289
methoxy(methyl)azanide;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (PubChem CID 131738289) has the molecular formula C9H19N2O5- and a molecular weight of 235.26 g/mol. Its IUPAC name is methoxy(methyl)azanide;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid.
| Compound Name | methoxy(methyl)azanide;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 131738289 |
| Molecular Formula | C9H19N2O5- |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | methoxy(methyl)azanide;2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCC(=O)O.C[N-]OC |
| InChI | InChI=1S/C7H13NO4.C2H6NO/c1-7(2,3)12-6(11)8-4-5(9)10;1-3-4-2/h4H2,1-3H3,(H,8,11)(H,9,10);1-2H3/q;-1 |
| InChIKey | GWPWVZIODIKJPW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|