C13H22N4O2 — CID 166772321
tert-butyl N-[[4-[(diaminoamino)methyl]phenyl]methyl]carbamate (PubChem CID 166772321) has the molecular formula C13H22N4O2 and a molecular weight of 266.35 g/mol. Its IUPAC name is tert-butyl N-[[4-[(diaminoamino)methyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(diaminoamino)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166772321 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | tert-butyl N-[[4-[(diaminoamino)methyl]phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CN(N)N)cc1 |
| InChI | InChI=1S/C13H22N4O2/c1-13(2,3)19-12(18)16-8-10-4-6-11(7-5-10)9-17(14)15/h4-7H,8-9,14-15H2,1-3H3,(H,16,18) |
| InChIKey | VNIAHLYVWSXNEM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|