C14H19NO2 — CID 86169082
tert-butyl N-[(4-ethenylphenyl)methyl]carbamate (PubChem CID 86169082) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is tert-butyl N-[(4-ethenylphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(4-ethenylphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 86169082 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl N-[(4-ethenylphenyl)methyl]carbamate |
| SMILES | C=Cc1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-5-11-6-8-12(9-7-11)10-15-13(16)17-14(2,3)4/h5-9H,1,10H2,2-4H3,(H,15,16) |
| InChIKey | BLZYHGGIQIGULI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |