C13H19NO3 — CID 143920464
tert-butyl N-[(4-formylphenyl)methyl]carbamate;molecular hydrogen (PubChem CID 143920464) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is tert-butyl N-[(4-formylphenyl)methyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[(4-formylphenyl)methyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 143920464 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | tert-butyl N-[(4-formylphenyl)methyl]carbamate;molecular hydrogen |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(C=O)cc1.[H][H] |
| InChI | InChI=1S/C13H17NO3.H2/c1-13(2,3)17-12(16)14-8-10-4-6-11(9-15)7-5-10;/h4-7,9H,8H2,1-3H3,(H,14,16);1H |
| InChIKey | LNLTZETVIACSCL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|