C19H25NO6 — CID 82581311
dimethyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]butanedioate (PubChem CID 82581311) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is dimethyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]butanedioate.
| Compound Name | dimethyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]butanedioate |
|---|---|
| PubChem CID | 82581311 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | dimethyl (2E)-2-[[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]methylidene]butanedioate |
| SMILES | COC(=O)C/C(=C\c1ccc(CNC(=O)OC(C)(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C19H25NO6/c1-19(2,3)26-18(23)20-12-14-8-6-13(7-9-14)10-15(17(22)25-5)11-16(21)24-4/h6-10H,11-12H2,1-5H3,(H,20,23)/b15-10+ |
| InChIKey | QJZNCDHXQNYDHN-XNTDXEJSSA-N |
| XLogP | 2.83 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|