C12H15F3N2O2 — CID 155895576
tert-butyl N-[[3-(trifluoromethyl)-2-pyridinyl]methyl]carbamate (PubChem CID 155895576) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is tert-butyl N-[[3-(trifluoromethyl)-2-pyridinyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[3-(trifluoromethyl)-2-pyridinyl]methyl]carbamate |
|---|---|
| PubChem CID | 155895576 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | tert-butyl N-[[3-(trifluoromethyl)-2-pyridinyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ncccc1C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-11(2,3)19-10(18)17-7-9-8(12(13,14)15)5-4-6-16-9/h4-6H,7H2,1-3H3,(H,17,18) |
| InChIKey | PMOBSQDTAVYZNI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |