C13H20N2O2 — CID 118168082
tert-butyl N-[(2-ethyl-3-pyridinyl)methyl]carbamate (PubChem CID 118168082) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is tert-butyl N-[(2-ethyl-3-pyridinyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(2-ethyl-3-pyridinyl)methyl]carbamate |
|---|---|
| PubChem CID | 118168082 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | tert-butyl N-[(2-ethyl-3-pyridinyl)methyl]carbamate |
| SMILES | CCc1ncccc1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-5-11-10(7-6-8-14-11)9-15-12(16)17-13(2,3)4/h6-8H,5,9H2,1-4H3,(H,15,16) |
| InChIKey | VUXWENXKQJUNQV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |