C9H13N — CID 14747123
2,3-diethylpyridine (PubChem CID 14747123) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,3-diethylpyridine.
| Compound Name | 2,3-diethylpyridine |
|---|---|
| PubChem CID | 14747123 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,3-diethylpyridine |
| SMILES | CCc1cccnc1CC |
| InChI | InChI=1S/C9H13N/c1-3-8-6-5-7-10-9(8)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | YXZUDXLWSOZHFN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |