C27H39N3 — CID 157436995
2,3-diethylpyridine;bis(2,4,6-trimethylaniline) (PubChem CID 157436995) has the molecular formula C27H39N3 and a molecular weight of 405.63 g/mol. Its IUPAC name is 2,3-diethylpyridine;bis(2,4,6-trimethylaniline).
| Compound Name | 2,3-diethylpyridine;bis(2,4,6-trimethylaniline) |
|---|---|
| PubChem CID | 157436995 |
| Molecular Formula | C27H39N3 |
| Molecular Weight | 405.63 g/mol |
| Exact Mass | 405.31 |
| IUPAC Name | 2,3-diethylpyridine;bis(2,4,6-trimethylaniline) |
| SMILES | CCc1cccnc1CC.Cc1cc(C)c(N)c(C)c1.Cc1cc(C)c(N)c(C)c1 |
| InChI | InChI=1S/3C9H13N/c2*1-6-4-7(2)9(10)8(3)5-6;1-3-8-6-5-7-10-9(8)4-2/h2*4-5H,10H2,1-3H3;5-7H,3-4H2,1-2H3 |
| InChIKey | BRFMKPJHXZDLHH-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|