About ethane;3-ethyl-2-methylpyridine
ethane;3-ethyl-2-methylpyridine (PubChem CID 143071594) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is ethane;3-ethyl-2-methylpyridine.
Molecular Properties
| Compound Name | ethane;3-ethyl-2-methylpyridine |
| PubChem CID | 143071594 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | ethane;3-ethyl-2-methylpyridine |
| SMILES | CC.CCc1cccnc1C |
| InChI | InChI=1S/C8H11N.C2H6/c1-3-8-5-4-6-9-7(8)2;1-2/h4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | VHMHTXPZXAEELT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-ethyl-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-2-methylpyridine?
The IUPAC name of ethane;3-ethyl-2-methylpyridine (CID 143071594) is ethane;3-ethyl-2-methylpyridine.
What is the SMILES notation for ethane;3-ethyl-2-methylpyridine?
The canonical SMILES for ethane;3-ethyl-2-methylpyridine is CC.CCc1cccnc1C.
What is the InChIKey of ethane;3-ethyl-2-methylpyridine?
The InChIKey is VHMHTXPZXAEELT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H6/c1-3-8-5-4-6-9-7(8)2;1-2/h4-6H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-ethyl-2-methylpyridine?
ethane;3-ethyl-2-methylpyridine has a molecular weight of 151.25 g/mol, XLogP of 2.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-2-methylpyridine is sourced from PubChem (CID 143071594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).