About ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine
ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine (PubChem CID 165410147) has the molecular formula C20H34N2
and a molecular weight of 302.51 g/mol. Its IUPAC name is ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine.
Molecular Properties
| Compound Name | ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine |
| PubChem CID | 165410147 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine |
| SMILES | CC.CC.CN.Cc1ccccc1CCc1cccnc1C |
| InChI | InChI=1S/C15H17N.2C2H6.CH5N/c1-12-6-3-4-7-14(12)9-10-15-8-5-11-16-13(15)2;3*1-2/h3-8,11H,9-10H2,1-2H3;2*1-2H3;2H2,1H3 |
| InChIKey | CUXBJBWPWSRYEM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine?
The IUPAC name of ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine (CID 165410147) is ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine.
What is the SMILES notation for ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine?
The canonical SMILES for ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine is CC.CC.CN.Cc1ccccc1CCc1cccnc1C.
What is the InChIKey of ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine?
The InChIKey is CUXBJBWPWSRYEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N.2C2H6.CH5N/c1-12-6-3-4-7-14(12)9-10-15-8-5-11-16-13(15)2;3*1-2/h3-8,11H,9-10H2,1-2H3;2*1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine?
ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine has a molecular weight of 302.51 g/mol, XLogP of 5.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;2-methyl-3-[2-(2-methylphenyl)ethyl]pyridine is sourced from PubChem (CID 165410147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).