C16H24N2 — CID 91413155
1,3-dimethyl-4-[2-(2-methylphenyl)ethyl]pyrazole;ethane (PubChem CID 91413155) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1,3-dimethyl-4-[2-(2-methylphenyl)ethyl]pyrazole;ethane.
| Compound Name | 1,3-dimethyl-4-[2-(2-methylphenyl)ethyl]pyrazole;ethane |
|---|---|
| PubChem CID | 91413155 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1,3-dimethyl-4-[2-(2-methylphenyl)ethyl]pyrazole;ethane |
| SMILES | CC.Cc1ccccc1CCc1cn(C)nc1C |
| InChI | InChI=1S/C14H18N2.C2H6/c1-11-6-4-5-7-13(11)8-9-14-10-16(3)15-12(14)2;1-2/h4-7,10H,8-9H2,1-3H3;1-2H3 |
| InChIKey | NLFBHCJSDZSZNZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |