C9H13CoN — CID 159454360
cobalt;2,4,6-trimethylaniline (PubChem CID 159454360) has the molecular formula C9H13CoN and a molecular weight of 194.14 g/mol. Its IUPAC name is cobalt;2,4,6-trimethylaniline.
| Compound Name | cobalt;2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 159454360 |
| Molecular Formula | C9H13CoN |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | cobalt;2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N)c(C)c1.[Co] |
| InChI | InChI=1S/C9H13N.Co/c1-6-4-7(2)9(10)8(3)5-6;/h4-5H,10H2,1-3H3; |
| InChIKey | ISZLWDCHHGYQOP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|