C9H12F2NP — CID 143122644
2-[difluoro(phosphanyl)methyl]-4,6-dimethylaniline (PubChem CID 143122644) has the molecular formula C9H12F2NP and a molecular weight of 203.17 g/mol. Its IUPAC name is 2-[difluoro(phosphanyl)methyl]-4,6-dimethylaniline.
| Compound Name | 2-[difluoro(phosphanyl)methyl]-4,6-dimethylaniline |
|---|---|
| PubChem CID | 143122644 |
| Molecular Formula | C9H12F2NP |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-[difluoro(phosphanyl)methyl]-4,6-dimethylaniline |
| SMILES | Cc1cc(C)c(N)c(C(F)(F)P)c1 |
| InChI | InChI=1S/C9H12F2NP/c1-5-3-6(2)8(12)7(4-5)9(10,11)13/h3-4H,12-13H2,1-2H3 |
| InChIKey | XMEYDYHWKYIXRF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|