C10H14F3N — CID 160577208
2,6-dimethyl-4-(trifluoromethyl)aniline;methane (PubChem CID 160577208) has the molecular formula C10H14F3N and a molecular weight of 205.22 g/mol. Its IUPAC name is 2,6-dimethyl-4-(trifluoromethyl)aniline;methane.
| Compound Name | 2,6-dimethyl-4-(trifluoromethyl)aniline;methane |
|---|---|
| PubChem CID | 160577208 |
| Molecular Formula | C10H14F3N |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,6-dimethyl-4-(trifluoromethyl)aniline;methane |
| SMILES | C.Cc1cc(C(F)(F)F)cc(C)c1N |
| InChI | InChI=1S/C9H10F3N.CH4/c1-5-3-7(9(10,11)12)4-6(2)8(5)13;/h3-4H,13H2,1-2H3;1H4 |
| InChIKey | RBHQXMWYGMUDNO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|