C11H15F3 — CID 143497301
1,3-dimethyl-5-(trifluoromethyl)benzene;ethane (PubChem CID 143497301) has the molecular formula C11H15F3 and a molecular weight of 204.23 g/mol. Its IUPAC name is 1,3-dimethyl-5-(trifluoromethyl)benzene;ethane.
| Compound Name | 1,3-dimethyl-5-(trifluoromethyl)benzene;ethane |
|---|---|
| PubChem CID | 143497301 |
| Molecular Formula | C11H15F3 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1,3-dimethyl-5-(trifluoromethyl)benzene;ethane |
| SMILES | CC.Cc1cc(C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3.C2H6/c1-6-3-7(2)5-8(4-6)9(10,11)12;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | GSGYFXWTSIVMSL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |