C13H24 — CID 91530079
ethane;1,3,5-trimethylbenzene (PubChem CID 91530079) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is ethane;1,3,5-trimethylbenzene.
| Compound Name | ethane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 91530079 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | ethane;1,3,5-trimethylbenzene |
| SMILES | CC.CC.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.2C2H6/c1-7-4-8(2)6-9(3)5-7;2*1-2/h4-6H,1-3H3;2*1-2H3 |
| InChIKey | CGRBRSHELKDUBI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |