C9H14OP+ — CID 162088075
oxophosphanium;1,3,5-trimethylbenzene (PubChem CID 162088075) has the molecular formula C9H14OP+ and a molecular weight of 169.18 g/mol. Its IUPAC name is oxophosphanium;1,3,5-trimethylbenzene.
| Compound Name | oxophosphanium;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 162088075 |
| Molecular Formula | C9H14OP+ |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | oxophosphanium;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.O=[PH2+] |
| InChI | InChI=1S/C9H12.H2OP/c1-7-4-8(2)6-9(3)5-7;1-2/h4-6H,1-3H3;2H2/q;+1 |
| InChIKey | JPYBHRIWRYDGML-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|