C9H12OS — CID 21060151
1,3-dimethyl-5-methylsulfinylbenzene (PubChem CID 21060151) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-methylsulfinylbenzene.
| Compound Name | 1,3-dimethyl-5-methylsulfinylbenzene |
|---|---|
| PubChem CID | 21060151 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 1,3-dimethyl-5-methylsulfinylbenzene |
| SMILES | Cc1cc(C)cc(S(C)=O)c1 |
| InChI | InChI=1S/C9H12OS/c1-7-4-8(2)6-9(5-7)11(3)10/h4-6H,1-3H3 |
| InChIKey | KCQLMKKQSSJFPY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |