C10H15OP — CID 174873264
phosphorosomethane;1,3,5-trimethylbenzene (PubChem CID 174873264) has the molecular formula C10H15OP and a molecular weight of 182.20 g/mol. Its IUPAC name is phosphorosomethane;1,3,5-trimethylbenzene.
| Compound Name | phosphorosomethane;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 174873264 |
| Molecular Formula | C10H15OP |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | phosphorosomethane;1,3,5-trimethylbenzene |
| SMILES | CP=O.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.CH3OP/c1-7-4-8(2)6-9(3)5-7;1-3-2/h4-6H,1-3H3;1H3 |
| InChIKey | JDNAVACIKXNKDK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|