About phosphorosobenzene;1,3,5-trimethylbenzene
phosphorosobenzene;1,3,5-trimethylbenzene (PubChem CID 174783868) has the molecular formula C15H17OP
and a molecular weight of 244.27 g/mol. Its IUPAC name is phosphorosobenzene;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | phosphorosobenzene;1,3,5-trimethylbenzene |
| PubChem CID | 174783868 |
| Molecular Formula | C15H17OP |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | phosphorosobenzene;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.O=Pc1ccccc1 |
| InChI | InChI=1S/C9H12.C6H5OP/c1-7-4-8(2)6-9(3)5-7;7-8-6-4-2-1-3-5-6/h4-6H,1-3H3;1-5H |
| InChIKey | SKFBZMOGAOMKDK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphorosobenzene;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphorosobenzene;1,3,5-trimethylbenzene?
The IUPAC name of phosphorosobenzene;1,3,5-trimethylbenzene (CID 174783868) is phosphorosobenzene;1,3,5-trimethylbenzene.
What is the SMILES notation for phosphorosobenzene;1,3,5-trimethylbenzene?
The canonical SMILES for phosphorosobenzene;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.O=Pc1ccccc1.
What is the InChIKey of phosphorosobenzene;1,3,5-trimethylbenzene?
The InChIKey is SKFBZMOGAOMKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H5OP/c1-7-4-8(2)6-9(3)5-7;7-8-6-4-2-1-3-5-6/h4-6H,1-3H3;1-5H.
What are the key properties of phosphorosobenzene;1,3,5-trimethylbenzene?
phosphorosobenzene;1,3,5-trimethylbenzene has a molecular weight of 244.27 g/mol, XLogP of 4.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phosphorosobenzene;1,3,5-trimethylbenzene is sourced from PubChem (CID 174783868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).