About trichlororuthenium;1,3,5-trimethylbenzene
trichlororuthenium;1,3,5-trimethylbenzene (PubChem CID 175712088) has the molecular formula C9H12Cl3Ru
and a molecular weight of 327.62 g/mol. Its IUPAC name is trichlororuthenium;1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | trichlororuthenium;1,3,5-trimethylbenzene |
| PubChem CID | 175712088 |
| Molecular Formula | C9H12Cl3Ru |
| Molecular Weight | 327.62 g/mol |
| Exact Mass | 326.90 |
| IUPAC Name | trichlororuthenium;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.Cl[Ru](Cl)Cl |
| InChI | InChI=1S/C9H12.3ClH.Ru/c1-7-4-8(2)6-9(3)5-7;;;;/h4-6H,1-3H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | ZPIKKKWOVKRELW-UHFFFAOYSA-K |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze trichlororuthenium;1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichlororuthenium;1,3,5-trimethylbenzene?
The IUPAC name of trichlororuthenium;1,3,5-trimethylbenzene (CID 175712088) is trichlororuthenium;1,3,5-trimethylbenzene.
What is the SMILES notation for trichlororuthenium;1,3,5-trimethylbenzene?
The canonical SMILES for trichlororuthenium;1,3,5-trimethylbenzene is Cc1cc(C)cc(C)c1.Cl[Ru](Cl)Cl.
What is the InChIKey of trichlororuthenium;1,3,5-trimethylbenzene?
The InChIKey is ZPIKKKWOVKRELW-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H12.3ClH.Ru/c1-7-4-8(2)6-9(3)5-7;;;;/h4-6H,1-3H3;3*1H;/q;;;;+3/p-3.
What are the key properties of trichlororuthenium;1,3,5-trimethylbenzene?
trichlororuthenium;1,3,5-trimethylbenzene has a molecular weight of 327.62 g/mol, XLogP of 4.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichlororuthenium;1,3,5-trimethylbenzene is sourced from PubChem (CID 175712088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).