C10H13N — CID 174826910
formonitrile;1,3,5-trimethylbenzene (PubChem CID 174826910) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is formonitrile;1,3,5-trimethylbenzene.
| Compound Name | formonitrile;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 174826910 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | formonitrile;1,3,5-trimethylbenzene |
| SMILES | C#N.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.CHN/c1-7-4-8(2)6-9(3)5-7;1-2/h4-6H,1-3H3;1H |
| InChIKey | DNNQXFKBLHPTQH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |