C9H12F2Xe — CID 175404691
difluoroxenon;1,3,5-trimethylbenzene (PubChem CID 175404691) has the molecular formula C9H12F2Xe and a molecular weight of 289.48 g/mol. Its IUPAC name is difluoroxenon;1,3,5-trimethylbenzene.
| Compound Name | difluoroxenon;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 175404691 |
| Molecular Formula | C9H12F2Xe |
| Molecular Weight | 289.48 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | difluoroxenon;1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)cc(C)c1.F[Xe]F |
| InChI | InChI=1S/C9H12.F2Xe/c1-7-4-8(2)6-9(3)5-7;1-3-2/h4-6H,1-3H3; |
| InChIKey | XKQJNHMLSPTDBO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |