About 3,5-dimethylaniline;hydrofluoride
3,5-dimethylaniline;hydrofluoride (PubChem CID 158073989) has the molecular formula C8H12FN
and a molecular weight of 141.19 g/mol. Its IUPAC name is 3,5-dimethylaniline;hydrofluoride.
Molecular Properties
| Compound Name | 3,5-dimethylaniline;hydrofluoride |
| PubChem CID | 158073989 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 3,5-dimethylaniline;hydrofluoride |
| SMILES | Cc1cc(C)cc(N)c1.F |
| InChI | InChI=1S/C8H11N.FH/c1-6-3-7(2)5-8(9)4-6;/h3-5H,9H2,1-2H3;1H |
| InChIKey | FMDOEGNGKYHLMD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethylaniline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylaniline;hydrofluoride?
The IUPAC name of 3,5-dimethylaniline;hydrofluoride (CID 158073989) is 3,5-dimethylaniline;hydrofluoride.
What is the SMILES notation for 3,5-dimethylaniline;hydrofluoride?
The canonical SMILES for 3,5-dimethylaniline;hydrofluoride is Cc1cc(C)cc(N)c1.F.
What is the InChIKey of 3,5-dimethylaniline;hydrofluoride?
The InChIKey is FMDOEGNGKYHLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.FH/c1-6-3-7(2)5-8(9)4-6;/h3-5H,9H2,1-2H3;1H.
What are the key properties of 3,5-dimethylaniline;hydrofluoride?
3,5-dimethylaniline;hydrofluoride has a molecular weight of 141.19 g/mol, XLogP of 2.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylaniline;hydrofluoride is sourced from PubChem (CID 158073989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).