About 3-chloro-5-methylaniline;ethane
3-chloro-5-methylaniline;ethane (PubChem CID 142083431) has the molecular formula C9H14ClN
and a molecular weight of 171.67 g/mol. Its IUPAC name is 3-chloro-5-methylaniline;ethane.
Molecular Properties
| Compound Name | 3-chloro-5-methylaniline;ethane |
| PubChem CID | 142083431 |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 3-chloro-5-methylaniline;ethane |
| SMILES | CC.Cc1cc(N)cc(Cl)c1 |
| InChI | InChI=1S/C7H8ClN.C2H6/c1-5-2-6(8)4-7(9)3-5;1-2/h2-4H,9H2,1H3;1-2H3 |
| InChIKey | XXEYQVRTPABLAE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.67 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-5-methylaniline;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5-methylaniline;ethane?
The IUPAC name of 3-chloro-5-methylaniline;ethane (CID 142083431) is 3-chloro-5-methylaniline;ethane.
What is the SMILES notation for 3-chloro-5-methylaniline;ethane?
The canonical SMILES for 3-chloro-5-methylaniline;ethane is CC.Cc1cc(N)cc(Cl)c1.
What is the InChIKey of 3-chloro-5-methylaniline;ethane?
The InChIKey is XXEYQVRTPABLAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN.C2H6/c1-5-2-6(8)4-7(9)3-5;1-2/h2-4H,9H2,1H3;1-2H3.
What are the key properties of 3-chloro-5-methylaniline;ethane?
3-chloro-5-methylaniline;ethane has a molecular weight of 171.67 g/mol, XLogP of 3.26, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5-methylaniline;ethane is sourced from PubChem (CID 142083431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).