C17H24N2 — CID 159725455
3,5-dimethylaniline;2,4,6-trimethylaniline (PubChem CID 159725455) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3,5-dimethylaniline;2,4,6-trimethylaniline.
| Compound Name | 3,5-dimethylaniline;2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 159725455 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 3,5-dimethylaniline;2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(N)c(C)c1.Cc1cc(C)cc(N)c1 |
| InChI | InChI=1S/C9H13N.C8H11N/c1-6-4-7(2)9(10)8(3)5-6;1-6-3-7(2)5-8(9)4-6/h4-5H,10H2,1-3H3;3-5H,9H2,1-2H3 |
| InChIKey | NAOPEOZXWNIMNX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|