C11H22N2S — CID 157177077
2,4-dimethyl-6-methylsulfanylaniline;methanamine;methane (PubChem CID 157177077) has the molecular formula C11H22N2S and a molecular weight of 214.38 g/mol. Its IUPAC name is 2,4-dimethyl-6-methylsulfanylaniline;methanamine;methane.
| Compound Name | 2,4-dimethyl-6-methylsulfanylaniline;methanamine;methane |
|---|---|
| PubChem CID | 157177077 |
| Molecular Formula | C11H22N2S |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 2,4-dimethyl-6-methylsulfanylaniline;methanamine;methane |
| SMILES | C.CN.CSc1cc(C)cc(C)c1N |
| InChI | InChI=1S/C9H13NS.CH5N.CH4/c1-6-4-7(2)9(10)8(5-6)11-3;1-2;/h4-5H,10H2,1-3H3;2H2,1H3;1H4 |
| InChIKey | AODCNXVKPKLJBK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|