C8H14Cl2N2S — CID 19431152
2-methyl-5-methylsulfanylbenzene-1,4-diamine;dihydrochloride (PubChem CID 19431152) has the molecular formula C8H14Cl2N2S and a molecular weight of 241.19 g/mol. Its IUPAC name is 2-methyl-5-methylsulfanylbenzene-1,4-diamine;dihydrochloride.
| Compound Name | 2-methyl-5-methylsulfanylbenzene-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 19431152 |
| Molecular Formula | C8H14Cl2N2S |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 2-methyl-5-methylsulfanylbenzene-1,4-diamine;dihydrochloride |
| SMILES | CSc1cc(N)c(C)cc1N.Cl.Cl |
| InChI | InChI=1S/C8H12N2S.2ClH/c1-5-3-7(10)8(11-2)4-6(5)9;;/h3-4H,9-10H2,1-2H3;2*1H |
| InChIKey | JNEZJIBITRBUJZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|