C7H11FN2O — CID 141142247
4-fluoro-6-methylbenzene-1,3-diamine;hydrate (PubChem CID 141142247) has the molecular formula C7H11FN2O and a molecular weight of 158.18 g/mol. Its IUPAC name is 4-fluoro-6-methylbenzene-1,3-diamine;hydrate.
| Compound Name | 4-fluoro-6-methylbenzene-1,3-diamine;hydrate |
|---|---|
| PubChem CID | 141142247 |
| Molecular Formula | C7H11FN2O |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4-fluoro-6-methylbenzene-1,3-diamine;hydrate |
| SMILES | Cc1cc(F)c(N)cc1N.O |
| InChI | InChI=1S/C7H9FN2.H2O/c1-4-2-5(8)7(10)3-6(4)9;/h2-3H,9-10H2,1H3;1H2 |
| InChIKey | VTRJTKXRGSAOGM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|