C9H11FN2O — CID 130507342
5-amino-4-fluoro-N,2-dimethylbenzamide (PubChem CID 130507342) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is 5-amino-4-fluoro-N,2-dimethylbenzamide.
| Compound Name | 5-amino-4-fluoro-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 130507342 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-amino-4-fluoro-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cc(N)c(F)cc1C |
| InChI | InChI=1S/C9H11FN2O/c1-5-3-7(10)8(11)4-6(5)9(13)12-2/h3-4H,11H2,1-2H3,(H,12,13) |
| InChIKey | FVSGDQCUVZNJAT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|