C10H12FNO — CID 148716978
5-fluoro-N,2,3-trimethylbenzamide (PubChem CID 148716978) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 5-fluoro-N,2,3-trimethylbenzamide.
| Compound Name | 5-fluoro-N,2,3-trimethylbenzamide |
|---|---|
| PubChem CID | 148716978 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 5-fluoro-N,2,3-trimethylbenzamide |
| SMILES | CNC(=O)c1cc(F)cc(C)c1C |
| InChI | InChI=1S/C10H12FNO/c1-6-4-8(11)5-9(7(6)2)10(13)12-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | NYHVHCCVVRLKNM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |