C8H6ClF2NO3S — CID 65367632
2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65367632) has the molecular formula C8H6ClF2NO3S and a molecular weight of 269.66 g/mol. Its IUPAC name is 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 65367632 |
| Molecular Formula | C8H6ClF2NO3S |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride |
| SMILES | CNC(=O)c1cc(F)cc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C8H6ClF2NO3S/c1-12-8(13)5-2-4(10)3-6(7(5)11)16(9,14)15/h2-3H,1H3,(H,12,13) |
| InChIKey | RITGWEDKOXFWPS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |