2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride

C8H6ClF2NO3S — CID 65367632

IUPAC2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride
SMILESCNC(=O)c1cc(F)cc(S(=O)(=O)Cl)c1F
InChIInChI=1S/C8H6ClF2NO3S/c1-12-8(13)5-2-4(10)3-6(7(5)11)16(9,14)15/h2-3H,1H3,(H,12,13)
InChIKeyRITGWEDKOXFWPS-UHFFFAOYSA-N
MW269.66 g/mol
LogP1.25
Rot. Bonds2

About 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride

2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride (PubChem CID 65367632) has the molecular formula C8H6ClF2NO3S and a molecular weight of 269.66 g/mol. Its IUPAC name is 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride.

Molecular Properties

Compound Name2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride
PubChem CID65367632
Molecular FormulaC8H6ClF2NO3S
Molecular Weight269.66 g/mol
Exact Mass268.97
IUPAC Name2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride
SMILESCNC(=O)c1cc(F)cc(S(=O)(=O)Cl)c1F
InChIInChI=1S/C8H6ClF2NO3S/c1-12-8(13)5-2-4(10)3-6(7(5)11)16(9,14)15/h2-3H,1H3,(H,12,13)
InChIKeyRITGWEDKOXFWPS-UHFFFAOYSA-N
XLogP1.25
TPSA63.24 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.66
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride?
The IUPAC name of 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride (CID 65367632) is 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride.
What is the SMILES notation for 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride?
The canonical SMILES for 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride is CNC(=O)c1cc(F)cc(S(=O)(=O)Cl)c1F.
What is the InChIKey of 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride?
The InChIKey is RITGWEDKOXFWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClF2NO3S/c1-12-8(13)5-2-4(10)3-6(7(5)11)16(9,14)15/h2-3H,1H3,(H,12,13).
What are the key properties of 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride?
2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride has a molecular weight of 269.66 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-3-(methylcarbamoyl)benzenesulfonyl chloride is sourced from PubChem (CID 65367632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).