C8H6F3NO — CID 58656809
2,3,5-trifluoro-N-methylbenzamide (PubChem CID 58656809) has the molecular formula C8H6F3NO and a molecular weight of 189.14 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-methylbenzamide.
| Compound Name | 2,3,5-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 58656809 |
| Molecular Formula | C8H6F3NO |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2,3,5-trifluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C8H6F3NO/c1-12-8(13)5-2-4(9)3-6(10)7(5)11/h2-3H,1H3,(H,12,13) |
| InChIKey | BXUKJHZZYBNGJH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|