C9H7F2NO2 — CID 82112280
2-(2,5-difluorophenyl)-N-methyl-2-oxoacetamide (PubChem CID 82112280) has the molecular formula C9H7F2NO2 and a molecular weight of 199.16 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-N-methyl-2-oxoacetamide.
| Compound Name | 2-(2,5-difluorophenyl)-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 82112280 |
| Molecular Formula | C9H7F2NO2 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-(2,5-difluorophenyl)-N-methyl-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H7F2NO2/c1-12-9(14)8(13)6-4-5(10)2-3-7(6)11/h2-4H,1H3,(H,12,14) |
| InChIKey | DTWPWXPUYDLKSB-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|