C16H12F2O — CID 59347721
(E)-1-(2,5-difluorophenyl)-2-methyl-3-phenylprop-2-en-1-one (PubChem CID 59347721) has the molecular formula C16H12F2O and a molecular weight of 258.27 g/mol. Its IUPAC name is (E)-1-(2,5-difluorophenyl)-2-methyl-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(2,5-difluorophenyl)-2-methyl-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 59347721 |
| Molecular Formula | C16H12F2O |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (E)-1-(2,5-difluorophenyl)-2-methyl-3-phenylprop-2-en-1-one |
| SMILES | C/C(=C\c1ccccc1)C(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H12F2O/c1-11(9-12-5-3-2-4-6-12)16(19)14-10-13(17)7-8-15(14)18/h2-10H,1H3/b11-9+ |
| InChIKey | WTWOWZCYVIYECW-PKNBQFBNSA-N |
| XLogP | 4.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|