C16H13F2NO — CID 6140397
(E)-N-(3,4-difluorophenyl)-2-methyl-3-phenylprop-2-enamide (PubChem CID 6140397) has the molecular formula C16H13F2NO and a molecular weight of 273.28 g/mol. Its IUPAC name is (E)-N-(3,4-difluorophenyl)-2-methyl-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3,4-difluorophenyl)-2-methyl-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6140397 |
| Molecular Formula | C16H13F2NO |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (E)-N-(3,4-difluorophenyl)-2-methyl-3-phenylprop-2-enamide |
| SMILES | C/C(=C\c1ccccc1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H13F2NO/c1-11(9-12-5-3-2-4-6-12)16(20)19-13-7-8-14(17)15(18)10-13/h2-10H,1H3,(H,19,20)/b11-9+ |
| InChIKey | JWAWKWFBWADFON-PKNBQFBNSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|