C22H21N3O — CID 145084891
(E)-3-(3,5-diaminophenyl)-2-methyl-N-(4-phenylphenyl)prop-2-enamide (PubChem CID 145084891) has the molecular formula C22H21N3O and a molecular weight of 343.43 g/mol. Its IUPAC name is (E)-3-(3,5-diaminophenyl)-2-methyl-N-(4-phenylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-diaminophenyl)-2-methyl-N-(4-phenylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 145084891 |
| Molecular Formula | C22H21N3O |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (E)-3-(3,5-diaminophenyl)-2-methyl-N-(4-phenylphenyl)prop-2-enamide |
| SMILES | C/C(=C\c1cc(N)cc(N)c1)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O/c1-15(11-16-12-19(23)14-20(24)13-16)22(26)25-21-9-7-18(8-10-21)17-5-3-2-4-6-17/h2-14H,23-24H2,1H3,(H,25,26)/b15-11+ |
| InChIKey | KZRIJGJOGFKMMW-RVDMUPIBSA-N |
| XLogP | 4.56 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|